C17H22BF3N2O4 — CID 76584676
[3-methyl-1-[[1-[[2-(trifluoromethyl)benzoyl]amino]cyclopropanecarbonyl]amino]butyl]boronic acid (PubChem CID 76584676) has the molecular formula C17H22BF3N2O4 and a molecular weight of 386.18 g/mol. Its IUPAC name is [3-methyl-1-[[1-[[2-(trifluoromethyl)benzoyl]amino]cyclopropanecarbonyl]amino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[[1-[[2-(trifluoromethyl)benzoyl]amino]cyclopropanecarbonyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 76584676 |
| Molecular Formula | C17H22BF3N2O4 |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [3-methyl-1-[[1-[[2-(trifluoromethyl)benzoyl]amino]cyclopropanecarbonyl]amino]butyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C1(NC(=O)c2ccccc2C(F)(F)F)CC1)B(O)O |
| InChI | InChI=1S/C17H22BF3N2O4/c1-10(2)9-13(18(26)27)22-15(25)16(7-8-16)23-14(24)11-5-3-4-6-12(11)17(19,20)21/h3-6,10,13,26-27H,7-9H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | LNTLLWNXNXAXNU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|