C11H20ClN3O3 — CID 11644816
2-amino-N-[2-[[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]amino]-2-oxoethyl]acetamide (PubChem CID 11644816) has the molecular formula C11H20ClN3O3 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-amino-N-[2-[[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]amino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 11644816 |
| Molecular Formula | C11H20ClN3O3 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-amino-N-[2-[[(3S)-1-chloro-5-methyl-2-oxohexan-3-yl]amino]-2-oxoethyl]acetamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)CN)C(=O)CCl |
| InChI | InChI=1S/C11H20ClN3O3/c1-7(2)3-8(9(16)4-12)15-11(18)6-14-10(17)5-13/h7-8H,3-6,13H2,1-2H3,(H,14,17)(H,15,18)/t8-/m0/s1 |
| InChIKey | FBHWCAZQLMLSIC-QMMMGPOBSA-N |
| XLogP | -0.60 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|