C10H21N5O3 — CID 178118398
2-[(2-aminoacetyl)amino]-N-(2-hydrazinyl-2-oxoethyl)-4-methylpentanamide (PubChem CID 178118398) has the molecular formula C10H21N5O3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-N-(2-hydrazinyl-2-oxoethyl)-4-methylpentanamide.
| Compound Name | 2-[(2-aminoacetyl)amino]-N-(2-hydrazinyl-2-oxoethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 178118398 |
| Molecular Formula | C10H21N5O3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-N-(2-hydrazinyl-2-oxoethyl)-4-methylpentanamide |
| SMILES | CC(C)CC(NC(=O)CN)C(=O)NCC(=O)NN |
| InChI | InChI=1S/C10H21N5O3/c1-6(2)3-7(14-8(16)4-11)10(18)13-5-9(17)15-12/h6-7H,3-5,11-12H2,1-2H3,(H,13,18)(H,14,16)(H,15,17) |
| InChIKey | JUUZVLNDROHSBI-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|