C12H22ClN3O4 — CID 14944803
1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)-1-nitrosourea (PubChem CID 14944803) has the molecular formula C12H22ClN3O4 and a molecular weight of 307.78 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)-1-nitrosourea |
|---|---|
| PubChem CID | 14944803 |
| Molecular Formula | C12H22ClN3O4 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)-1-nitrosourea |
| SMILES | CC(C)C1(NC(=O)N(CCCl)N=O)COC(C)(C)OC1 |
| InChI | InChI=1S/C12H22ClN3O4/c1-9(2)12(7-19-11(3,4)20-8-12)14-10(17)16(15-18)6-5-13/h9H,5-8H2,1-4H3,(H,14,17) |
| InChIKey | HWVZINCYPLLQTB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|