C11H23ClN3O5P — CID 57119236
1-(2-chloroethyl)-3-(1-diethoxyphosphorylbutyl)-1-nitrosourea (PubChem CID 57119236) has the molecular formula C11H23ClN3O5P and a molecular weight of 343.75 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(1-diethoxyphosphorylbutyl)-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-(1-diethoxyphosphorylbutyl)-1-nitrosourea |
|---|---|
| PubChem CID | 57119236 |
| Molecular Formula | C11H23ClN3O5P |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(2-chloroethyl)-3-(1-diethoxyphosphorylbutyl)-1-nitrosourea |
| SMILES | CCCC(NC(=O)N(CCCl)N=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H23ClN3O5P/c1-4-7-10(21(18,19-5-2)20-6-3)13-11(16)15(14-17)9-8-12/h10H,4-9H2,1-3H3,(H,13,16) |
| InChIKey | SCXHALASQDHCFS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|