C16H25ClN3O6P — CID 13343439
1-(2-chloroethyl)-3-[1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethyl]-1-nitrosourea (PubChem CID 13343439) has the molecular formula C16H25ClN3O6P and a molecular weight of 421.82 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethyl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethyl]-1-nitrosourea |
|---|---|
| PubChem CID | 13343439 |
| Molecular Formula | C16H25ClN3O6P |
| Molecular Weight | 421.82 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-(2-chloroethyl)-3-[1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethyl]-1-nitrosourea |
| SMILES | CCOP(=O)(OCC)C(Cc1ccc(OC)cc1)NC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C16H25ClN3O6P/c1-4-25-27(23,26-5-2)15(18-16(21)20(19-22)11-10-17)12-13-6-8-14(24-3)9-7-13/h6-9,15H,4-5,10-12H2,1-3H3,(H,18,21) |
| InChIKey | KLLACFSFINZMGT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|