C17H26N3O7P — CID 170025059
benzyl 3-[1-diethoxyphosphorylethylcarbamoyl(nitroso)amino]propanoate (PubChem CID 170025059) has the molecular formula C17H26N3O7P and a molecular weight of 415.38 g/mol. Its IUPAC name is benzyl 3-[1-diethoxyphosphorylethylcarbamoyl(nitroso)amino]propanoate.
| Compound Name | benzyl 3-[1-diethoxyphosphorylethylcarbamoyl(nitroso)amino]propanoate |
|---|---|
| PubChem CID | 170025059 |
| Molecular Formula | C17H26N3O7P |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | benzyl 3-[1-diethoxyphosphorylethylcarbamoyl(nitroso)amino]propanoate |
| SMILES | CCOP(=O)(OCC)C(C)NC(=O)N(CCC(=O)OCc1ccccc1)N=O |
| InChI | InChI=1S/C17H26N3O7P/c1-4-26-28(24,27-5-2)14(3)18-17(22)20(19-23)12-11-16(21)25-13-15-9-7-6-8-10-15/h6-10,14H,4-5,11-13H2,1-3H3,(H,18,22) |
| InChIKey | YOQGQXVQKFYFKN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|