C17H26NO6P — CID 154702034
[1-(methoxycarbonylamino)-2-methylbutyl]-(3-oxo-3-phenylmethoxypropyl)phosphinic acid (PubChem CID 154702034) has the molecular formula C17H26NO6P and a molecular weight of 371.37 g/mol. Its IUPAC name is [1-(methoxycarbonylamino)-2-methylbutyl]-(3-oxo-3-phenylmethoxypropyl)phosphinic acid.
| Compound Name | [1-(methoxycarbonylamino)-2-methylbutyl]-(3-oxo-3-phenylmethoxypropyl)phosphinic acid |
|---|---|
| PubChem CID | 154702034 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [1-(methoxycarbonylamino)-2-methylbutyl]-(3-oxo-3-phenylmethoxypropyl)phosphinic acid |
| SMILES | CCC(C)C(NC(=O)OC)P(=O)(O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H26NO6P/c1-4-13(2)16(18-17(20)23-3)25(21,22)11-10-15(19)24-12-14-8-6-5-7-9-14/h5-9,13,16H,4,10-12H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | DVBJHSWSOGAEOR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|