C34H36NO6P — CID 11060960
ethyl 3-[benzhydryloxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate (PubChem CID 11060960) has the molecular formula C34H36NO6P and a molecular weight of 585.64 g/mol. Its IUPAC name is ethyl 3-[benzhydryloxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate.
| Compound Name | ethyl 3-[benzhydryloxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate |
|---|---|
| PubChem CID | 11060960 |
| Molecular Formula | C34H36NO6P |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | ethyl 3-[benzhydryloxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoate |
| SMILES | CCOC(=O)CCP(=O)(OC(c1ccccc1)c1ccccc1)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H36NO6P/c1-2-39-32(36)23-24-42(38,41-33(29-19-11-5-12-20-29)30-21-13-6-14-22-30)31(25-27-15-7-3-8-16-27)35-34(37)40-26-28-17-9-4-10-18-28/h3-22,31,33H,2,23-26H2,1H3,(H,35,37) |
| InChIKey | FQIJDURQBWSTNB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|