C26H34N3O6P — CID 134929256
benzyl N-[1-(1-diethoxyphosphorylethylamino)-3-(1H-indol-2-yl)-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 134929256) has the molecular formula C26H34N3O6P and a molecular weight of 515.55 g/mol. Its IUPAC name is benzyl N-[1-(1-diethoxyphosphorylethylamino)-3-(1H-indol-2-yl)-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[1-(1-diethoxyphosphorylethylamino)-3-(1H-indol-2-yl)-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 134929256 |
| Molecular Formula | C26H34N3O6P |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | benzyl N-[1-(1-diethoxyphosphorylethylamino)-3-(1H-indol-2-yl)-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CCOP(=O)(OCC)C(C)NC(=O)C(Cc1cc2ccccc2[nH]1)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34N3O6P/c1-5-34-36(32,35-6-2)19(3)27-25(30)24(17-22-16-21-14-10-11-15-23(21)28-22)29(4)26(31)33-18-20-12-8-7-9-13-20/h7-16,19,24,28H,5-6,17-18H2,1-4H3,(H,27,30) |
| InChIKey | HBWMITIIKNGOIZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|