C21H32ClN3O9 — CID 18602978
1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-[(4-methoxyphenyl)methyl]-3-nitrosourea (PubChem CID 18602978) has the molecular formula C21H32ClN3O9 and a molecular weight of 505.95 g/mol. Its IUPAC name is 1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-[(4-methoxyphenyl)methyl]-3-nitrosourea.
| Compound Name | 1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-[(4-methoxyphenyl)methyl]-3-nitrosourea |
|---|---|
| PubChem CID | 18602978 |
| Molecular Formula | C21H32ClN3O9 |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-[(4-methoxyphenyl)methyl]-3-nitrosourea |
| SMILES | CCCCO[C@H]1O[C@H](C(O)N(Cc2ccc(OC)cc2)C(=O)N(CCCl)N=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H32ClN3O9/c1-3-4-11-33-20-17(28)15(26)16(27)18(34-20)19(29)24(21(30)25(23-31)10-9-22)12-13-5-7-14(32-2)8-6-13/h5-8,15-20,26-29H,3-4,9-12H2,1-2H3/t15-,16-,17+,18-,19?,20-/m0/s1 |
| InChIKey | RJNYVAMGXBXKOX-CDUFMIHHSA-N |
| XLogP | 0.78 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|