C17H32ClN3O8 — CID 18602952
1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea (PubChem CID 18602952) has the molecular formula C17H32ClN3O8 and a molecular weight of 441.91 g/mol. Its IUPAC name is 1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea.
| Compound Name | 1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea |
|---|---|
| PubChem CID | 18602952 |
| Molecular Formula | C17H32ClN3O8 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[[(2S,3S,4S,5R,6S)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea |
| SMILES | CCCCO[C@H]1O[C@H](C(O)N(CC(C)C)C(=O)N(CCCl)N=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H32ClN3O8/c1-4-5-8-28-16-13(24)11(22)12(23)14(29-16)15(25)20(9-10(2)3)17(26)21(19-27)7-6-18/h10-16,22-25H,4-9H2,1-3H3/t11-,12-,13+,14-,15?,16-/m0/s1 |
| InChIKey | JFQKGDUWZBBZDL-SOIIWHHFSA-N |
| XLogP | 0.23 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|