C16H30ClN3O8 — CID 18602976
1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxan-2-yl]methyl]-1-nitroso-3-propylurea (PubChem CID 18602976) has the molecular formula C16H30ClN3O8 and a molecular weight of 427.88 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxan-2-yl]methyl]-1-nitroso-3-propylurea.
| Compound Name | 1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxan-2-yl]methyl]-1-nitroso-3-propylurea |
|---|---|
| PubChem CID | 18602976 |
| Molecular Formula | C16H30ClN3O8 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-(2-chloroethyl)-3-[hydroxy-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxan-2-yl]methyl]-1-nitroso-3-propylurea |
| SMILES | CCCN(C(=O)N(CCCl)N=O)C(O)[C@H]1O[C@H](OCC(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H30ClN3O8/c1-4-6-19(16(25)20(18-26)7-5-17)14(24)13-11(22)10(21)12(23)15(28-13)27-8-9(2)3/h9-15,21-24H,4-8H2,1-3H3/t10-,11-,12+,13-,14?,15-/m0/s1 |
| InChIKey | KTTRRTZEDWJAQR-GTKKKQGKSA-N |
| XLogP | -0.16 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|