C11H20ClN3O8 — CID 22808139
1-(2-chloroethyl)-3-[[(2S,3S,4S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-nitrosourea (PubChem CID 22808139) has the molecular formula C11H20ClN3O8 and a molecular weight of 357.75 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[[(2S,3S,4S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[[(2S,3S,4S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-nitrosourea |
|---|---|
| PubChem CID | 22808139 |
| Molecular Formula | C11H20ClN3O8 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-(2-chloroethyl)-3-[[(2S,3S,4S,5R,6R)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-nitrosourea |
| SMILES | CCO[C@@H]1O[C@H](C(O)NC(=O)N(CCCl)N=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20ClN3O8/c1-2-22-10-7(18)5(16)6(17)8(23-10)9(19)13-11(20)15(14-21)4-3-12/h5-10,16-19H,2-4H2,1H3,(H,13,20)/t5-,6-,7+,8-,9?,10+/m0/s1 |
| InChIKey | PAQIAEWYDYRZNR-KDVPAGTJSA-N |
| XLogP | -1.92 |
| TPSA | 161.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|