C11H21N3O8 — CID 22808135
3-[[(2S,3S,4S,5R,6S)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-ethyl-1-nitrosourea (PubChem CID 22808135) has the molecular formula C11H21N3O8 and a molecular weight of 323.30 g/mol. Its IUPAC name is 3-[[(2S,3S,4S,5R,6S)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-ethyl-1-nitrosourea.
| Compound Name | 3-[[(2S,3S,4S,5R,6S)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-ethyl-1-nitrosourea |
|---|---|
| PubChem CID | 22808135 |
| Molecular Formula | C11H21N3O8 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[[(2S,3S,4S,5R,6S)-6-ethoxy-3,4,5-trihydroxyoxan-2-yl]-hydroxymethyl]-1-ethyl-1-nitrosourea |
| SMILES | CCO[C@H]1O[C@H](C(O)NC(=O)N(CC)N=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21N3O8/c1-3-14(13-20)11(19)12-9(18)8-6(16)5(15)7(17)10(22-8)21-4-2/h5-10,15-18H,3-4H2,1-2H3,(H,12,19)/t5-,6-,7+,8-,9?,10-/m0/s1 |
| InChIKey | WVLKMNWRRKEGQF-OEWAQJTESA-N |
| XLogP | -2.14 |
| TPSA | 161.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|