C14H27N3O7 — CID 22816411
3-[(2R)-2-[(2R,3R,4R)-5-ethoxy-4-hydroxy-3-propoxyoxolan-2-yl]-2-methoxyethyl]-1-methyl-1-nitrosourea (PubChem CID 22816411) has the molecular formula C14H27N3O7 and a molecular weight of 349.38 g/mol. Its IUPAC name is 3-[(2R)-2-[(2R,3R,4R)-5-ethoxy-4-hydroxy-3-propoxyoxolan-2-yl]-2-methoxyethyl]-1-methyl-1-nitrosourea.
| Compound Name | 3-[(2R)-2-[(2R,3R,4R)-5-ethoxy-4-hydroxy-3-propoxyoxolan-2-yl]-2-methoxyethyl]-1-methyl-1-nitrosourea |
|---|---|
| PubChem CID | 22816411 |
| Molecular Formula | C14H27N3O7 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-[(2R)-2-[(2R,3R,4R)-5-ethoxy-4-hydroxy-3-propoxyoxolan-2-yl]-2-methoxyethyl]-1-methyl-1-nitrosourea |
| SMILES | CCCO[C@H]1[C@@H]([C@@H](CNC(=O)N(C)N=O)OC)OC(OCC)[C@@H]1O |
| InChI | InChI=1S/C14H27N3O7/c1-5-7-23-12-10(18)13(22-6-2)24-11(12)9(21-4)8-15-14(19)17(3)16-20/h9-13,18H,5-8H2,1-4H3,(H,15,19)/t9-,10-,11-,12-,13?/m1/s1 |
| InChIKey | WLDOCTAYHOKVIC-JVASRFHESA-N |
| XLogP | 0.24 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|