C13H26O6 — CID 23272614
(2R,3R,4R,5R)-2-butoxy-5-(1,2-dimethoxyethyl)-4-methoxyoxolan-3-ol (PubChem CID 23272614) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-butoxy-5-(1,2-dimethoxyethyl)-4-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-2-butoxy-5-(1,2-dimethoxyethyl)-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 23272614 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (2R,3R,4R,5R)-2-butoxy-5-(1,2-dimethoxyethyl)-4-methoxyoxolan-3-ol |
| SMILES | CCCCO[C@@H]1O[C@H](C(COC)OC)[C@H](OC)[C@H]1O |
| InChI | InChI=1S/C13H26O6/c1-5-6-7-18-13-10(14)12(17-4)11(19-13)9(16-3)8-15-2/h9-14H,5-8H2,1-4H3/t9?,10-,11-,12-,13-/m1/s1 |
| InChIKey | WXGLPXYTAZYKMP-SFPZXJLLSA-N |
| XLogP | 0.57 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|