C10H19N3O7 — CID 54400954
3-[(2R)-2-[(2R,3R,4R,5S)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea (PubChem CID 54400954) has the molecular formula C10H19N3O7 and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-[(2R)-2-[(2R,3R,4R,5S)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea.
| Compound Name | 3-[(2R)-2-[(2R,3R,4R,5S)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea |
|---|---|
| PubChem CID | 54400954 |
| Molecular Formula | C10H19N3O7 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[(2R)-2-[(2R,3R,4R,5S)-5-ethoxy-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea |
| SMILES | CCO[C@H]1O[C@H]([C@H](O)CNC(=O)N(C)N=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H19N3O7/c1-3-19-9-7(16)6(15)8(20-9)5(14)4-11-10(17)13(2)12-18/h5-9,14-16H,3-4H2,1-2H3,(H,11,17)/t5-,6-,7-,8-,9+/m1/s1 |
| InChIKey | VNJQWZGZMSPQDY-OKNNCHMLSA-N |
| XLogP | -1.85 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|