C9H17N3O7 — CID 59865183
1-methyl-1-nitroso-3-[[(2R,4R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]urea (PubChem CID 59865183) has the molecular formula C9H17N3O7 and a molecular weight of 279.25 g/mol. Its IUPAC name is 1-methyl-1-nitroso-3-[[(2R,4R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]urea.
| Compound Name | 1-methyl-1-nitroso-3-[[(2R,4R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 59865183 |
| Molecular Formula | C9H17N3O7 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-methyl-1-nitroso-3-[[(2R,4R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]urea |
| SMILES | CN(N=O)C(=O)NCC1[C@H](O)OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H17N3O7/c1-12(11-18)9(17)10-2-4-6(14)7(15)5(3-13)19-8(4)16/h4-8,13-16H,2-3H2,1H3,(H,10,17)/t4?,5?,6-,7+,8-/m1/s1 |
| InChIKey | XLWUDTNYRVSKEH-COJRLMGWSA-N |
| XLogP | -2.64 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|