C8H17N3O11S — CID 87918179
1-methyl-1-nitroso-3-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea;sulfuric acid (PubChem CID 87918179) has the molecular formula C8H17N3O11S and a molecular weight of 363.30 g/mol. Its IUPAC name is 1-methyl-1-nitroso-3-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea;sulfuric acid.
| Compound Name | 1-methyl-1-nitroso-3-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea;sulfuric acid |
|---|---|
| PubChem CID | 87918179 |
| Molecular Formula | C8H17N3O11S |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 1-methyl-1-nitroso-3-[(2S,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea;sulfuric acid |
| SMILES | CN(N=O)C(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C8H15N3O7.H2O4S/c1-11(10-17)8(16)9-4-6(14)5(13)3(2-12)18-7(4)15;1-5(2,3)4/h3-7,12-15H,2H2,1H3,(H,9,16);(H2,1,2,3,4)/t3-,4-,5-,6-,7+;/m1./s1 |
| InChIKey | KPEWHJUFAHUPBG-XOOUXKSCSA-N |
| XLogP | -3.54 |
| TPSA | 226.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|