C9H17N3O6 — CID 149368565
1-methyl-1-(methylideneamino)-3-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea (PubChem CID 149368565) has the molecular formula C9H17N3O6 and a molecular weight of 263.25 g/mol. Its IUPAC name is 1-methyl-1-(methylideneamino)-3-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea.
| Compound Name | 1-methyl-1-(methylideneamino)-3-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
|---|---|
| PubChem CID | 149368565 |
| Molecular Formula | C9H17N3O6 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-methyl-1-(methylideneamino)-3-[(2R,4S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
| SMILES | C=NN(C)C(=O)NC1[C@H](O)OC(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17N3O6/c1-10-12(2)9(17)11-5-7(15)6(14)4(3-13)18-8(5)16/h4-8,13-16H,1,3H2,2H3,(H,11,17)/t4?,5?,6-,7+,8-/m1/s1 |
| InChIKey | YJISHHIMNJYPGV-COJRLMGWSA-N |
| XLogP | -2.96 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|