C10H17NO6 — CID 118661257
N-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]prop-2-enamide (PubChem CID 118661257) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 118661257 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1C(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H17NO6/c1-2-7(13)11-3-5-8(14)9(15)6(4-12)17-10(5)16/h2,5-6,8-10,12,14-16H,1,3-4H2,(H,11,13) |
| InChIKey | GIVYFMMHRBAAGG-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|