C10H17NO5 — CID 24946412
(3R,4R,5S,6R)-3-(buta-1,3-dien-2-ylamino)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 24946412) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-(buta-1,3-dien-2-ylamino)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-3-(buta-1,3-dien-2-ylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 24946412 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3R,4R,5S,6R)-3-(buta-1,3-dien-2-ylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | C=CC(=C)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H17NO5/c1-3-5(2)11-7-9(14)8(13)6(4-12)16-10(7)15/h3,6-15H,1-2,4H2/t6-,7-,8-,9-,10?/m1/s1 |
| InChIKey | IZSLTOJPVNTVRK-WWGUJXLXSA-N |
| XLogP | -1.92 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|