C9H15NO6 — CID 25138373
N-[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide (PubChem CID 25138373) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is N-[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 25138373 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H15NO6/c1-2-5(12)10-6-8(14)7(13)4(3-11)16-9(6)15/h2,4,6-9,11,13-15H,1,3H2,(H,10,12)/t4-,6+,7-,8-,9?/m1/s1 |
| InChIKey | AATRYIJEAAJBBP-TVCQNHEDSA-N |
| XLogP | -2.91 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|