C6H12ClNO5 — CID 91580441
(2R,4R,5S)-3-(chloroamino)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 91580441) has the molecular formula C6H12ClNO5 and a molecular weight of 213.62 g/mol. Its IUPAC name is (2R,4R,5S)-3-(chloroamino)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,4R,5S)-3-(chloroamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 91580441 |
| Molecular Formula | C6H12ClNO5 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | (2R,4R,5S)-3-(chloroamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OCC1O[C@@H](O)C(NCl)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12ClNO5/c7-8-3-5(11)4(10)2(1-9)13-6(3)12/h2-6,8-12H,1H2/t2?,3?,4-,5-,6-/m1/s1 |
| InChIKey | XYOGKVPHCRPCHM-YHMDAOSXSA-N |
| XLogP | -2.47 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|