C7H14NO5SV- — CID 58472988
(3S,4R,5R,6R)-6-(hydroxymethyl)-3-(methanidylamino)oxane-2,4,5-triol;sulfanylidenevanadium (PubChem CID 58472988) has the molecular formula C7H14NO5SV- and a molecular weight of 275.20 g/mol. Its IUPAC name is (3S,4R,5R,6R)-6-(hydroxymethyl)-3-(methanidylamino)oxane-2,4,5-triol;sulfanylidenevanadium.
| Compound Name | (3S,4R,5R,6R)-6-(hydroxymethyl)-3-(methanidylamino)oxane-2,4,5-triol;sulfanylidenevanadium |
|---|---|
| PubChem CID | 58472988 |
| Molecular Formula | C7H14NO5SV- |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | (3S,4R,5R,6R)-6-(hydroxymethyl)-3-(methanidylamino)oxane-2,4,5-triol;sulfanylidenevanadium |
| SMILES | S=[V].[CH2-]N[C@@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14NO5.S.V/c1-8-4-6(11)5(10)3(2-9)13-7(4)12;;/h3-12H,1-2H2;;/q-1;;/t3-,4+,5+,6-,7?;;/m1../s1 |
| InChIKey | AVKMWNAERAKVPK-CFFNJQIDSA-N |
| XLogP | -2.19 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|