C12H25Cl2N2O4P — CID 10044227
methyl 2-[[bis(2-chloroethyl)amino-ethoxyphosphoryl]amino]-3-methylbutanoate (PubChem CID 10044227) has the molecular formula C12H25Cl2N2O4P and a molecular weight of 363.22 g/mol. Its IUPAC name is methyl 2-[[bis(2-chloroethyl)amino-ethoxyphosphoryl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[bis(2-chloroethyl)amino-ethoxyphosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10044227 |
| Molecular Formula | C12H25Cl2N2O4P |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[[bis(2-chloroethyl)amino-ethoxyphosphoryl]amino]-3-methylbutanoate |
| SMILES | CCOP(=O)(NC(C(=O)OC)C(C)C)N(CCCl)CCCl |
| InChI | InChI=1S/C12H25Cl2N2O4P/c1-5-20-21(18,16(8-6-13)9-7-14)15-11(10(2)3)12(17)19-4/h10-11H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | YOHXAEMSHBAHMM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|