C13H20NO4P — CID 71426419
(2S)-2-[[ethoxy(phenyl)phosphoryl]amino]-3-methylbutanoic acid (PubChem CID 71426419) has the molecular formula C13H20NO4P and a molecular weight of 285.28 g/mol. Its IUPAC name is (2S)-2-[[ethoxy(phenyl)phosphoryl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[ethoxy(phenyl)phosphoryl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 71426419 |
| Molecular Formula | C13H20NO4P |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2S)-2-[[ethoxy(phenyl)phosphoryl]amino]-3-methylbutanoic acid |
| SMILES | CCOP(=O)(N[C@H](C(=O)O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H20NO4P/c1-4-18-19(17,11-8-6-5-7-9-11)14-12(10(2)3)13(15)16/h5-10,12H,4H2,1-3H3,(H,14,17)(H,15,16)/t12-,19?/m0/s1 |
| InChIKey | XBWHZIVCJWWZEO-HSLMYDHPSA-N |
| XLogP | 2.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|