C10H22NO5P — CID 119083769
(2S,3S)-2-(diethoxyphosphorylamino)-3-methylpentanoic acid (PubChem CID 119083769) has the molecular formula C10H22NO5P and a molecular weight of 267.26 g/mol. Its IUPAC name is (2S,3S)-2-(diethoxyphosphorylamino)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-(diethoxyphosphorylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119083769 |
| Molecular Formula | C10H22NO5P |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2S,3S)-2-(diethoxyphosphorylamino)-3-methylpentanoic acid |
| SMILES | CCOP(=O)(N[C@H](C(=O)O)[C@@H](C)CC)OCC |
| InChI | InChI=1S/C10H22NO5P/c1-5-8(4)9(10(12)13)11-17(14,15-6-2)16-7-3/h8-9H,5-7H2,1-4H3,(H,11,14)(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | FMWDBVFEALGZGL-IUCAKERBSA-N |
| XLogP | 2.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|