C5H12NO5PW2 — CID 170514941
(2R)-2-[[ethoxy(hydroxy)phosphoryl]amino]propanoic acid;tungsten (PubChem CID 170514941) has the molecular formula C5H12NO5PW2 and a molecular weight of 564.81 g/mol. Its IUPAC name is (2R)-2-[[ethoxy(hydroxy)phosphoryl]amino]propanoic acid;tungsten.
| Compound Name | (2R)-2-[[ethoxy(hydroxy)phosphoryl]amino]propanoic acid;tungsten |
|---|---|
| PubChem CID | 170514941 |
| Molecular Formula | C5H12NO5PW2 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.95 |
| IUPAC Name | (2R)-2-[[ethoxy(hydroxy)phosphoryl]amino]propanoic acid;tungsten |
| SMILES | CCOP(=O)(O)N[C@H](C)C(=O)O.[W].[W] |
| InChI | InChI=1S/C5H12NO5P.2W/c1-3-11-12(9,10)6-4(2)5(7)8;;/h4H,3H2,1-2H3,(H,7,8)(H2,6,9,10);;/t4-;;/m1../s1 |
| InChIKey | OEYIAUFDOXXYTK-RZFWHQLPSA-N |
| XLogP | 0.18 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|