C13H25N2O8PS — CID 175908952
(E)-but-2-enedioic acid;ethyl (2S)-2-[[2-aminoethylsulfanyl(ethoxy)phosphoryl]amino]propanoate (PubChem CID 175908952) has the molecular formula C13H25N2O8PS and a molecular weight of 400.39 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;ethyl (2S)-2-[[2-aminoethylsulfanyl(ethoxy)phosphoryl]amino]propanoate.
| Compound Name | (E)-but-2-enedioic acid;ethyl (2S)-2-[[2-aminoethylsulfanyl(ethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 175908952 |
| Molecular Formula | C13H25N2O8PS |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (E)-but-2-enedioic acid;ethyl (2S)-2-[[2-aminoethylsulfanyl(ethoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OCC)SCCN.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H21N2O4PS.C4H4O4/c1-4-14-9(12)8(3)11-16(13,15-5-2)17-7-6-10;5-3(6)1-2-4(7)8/h8H,4-7,10H2,1-3H3,(H,11,13);1-2H,(H,5,6)(H,7,8)/b;2-1+/t8-,16?;/m0./s1 |
| InChIKey | KCTGYRFUPZVHRB-VCRYYGMPSA-N |
| XLogP | 1.08 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|