C7H20N3O3PSSi — CID 174086005
ethyl (2S)-2-[[amino(2-aminoethylsulfanyl)phosphoryl]-silylamino]propanoate (PubChem CID 174086005) has the molecular formula C7H20N3O3PSSi and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl (2S)-2-[[amino(2-aminoethylsulfanyl)phosphoryl]-silylamino]propanoate.
| Compound Name | ethyl (2S)-2-[[amino(2-aminoethylsulfanyl)phosphoryl]-silylamino]propanoate |
|---|---|
| PubChem CID | 174086005 |
| Molecular Formula | C7H20N3O3PSSi |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | ethyl (2S)-2-[[amino(2-aminoethylsulfanyl)phosphoryl]-silylamino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N([SiH3])P(N)(=O)SCCN |
| InChI | InChI=1S/C7H20N3O3PSSi/c1-3-13-7(11)6(2)10(16)14(9,12)15-5-4-8/h6H,3-5,8H2,1-2,16H3,(H2,9,12)/t6-,14?/m0/s1 |
| InChIKey | PMXRVBPBZDAIPA-TZKMECQKSA-N |
| XLogP | -0.72 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|