C12H24NO7P — CID 126586894
methyl (2S)-2-[[1-ethoxycarbonyloxyethoxy(methyl)phosphoryl]amino]-3-methylbutanoate (PubChem CID 126586894) has the molecular formula C12H24NO7P and a molecular weight of 325.30 g/mol. Its IUPAC name is methyl (2S)-2-[[1-ethoxycarbonyloxyethoxy(methyl)phosphoryl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[1-ethoxycarbonyloxyethoxy(methyl)phosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 126586894 |
| Molecular Formula | C12H24NO7P |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | methyl (2S)-2-[[1-ethoxycarbonyloxyethoxy(methyl)phosphoryl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)OC(C)OP(C)(=O)N[C@H](C(=O)OC)C(C)C |
| InChI | InChI=1S/C12H24NO7P/c1-7-18-12(15)19-9(4)20-21(6,16)13-10(8(2)3)11(14)17-5/h8-10H,7H2,1-6H3,(H,13,16)/t9?,10-,21?/m0/s1 |
| InChIKey | QSYOQTKPUFQZJN-ODQZVWNJSA-N |
| XLogP | 2.13 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|