About ethanol;ethyl methyl carbonate
ethanol;ethyl methyl carbonate (PubChem CID 161101393) has the molecular formula C6H14O4
and a molecular weight of 150.17 g/mol. Its IUPAC name is ethanol;ethyl methyl carbonate.
Molecular Properties
| Compound Name | ethanol;ethyl methyl carbonate |
| PubChem CID | 161101393 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | ethanol;ethyl methyl carbonate |
| SMILES | CCO.CCOC(=O)OC |
| InChI | InChI=1S/C4H8O3.C2H6O/c1-3-7-4(5)6-2;1-2-3/h3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | UILXAFGEPVTJKG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethanol;ethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl methyl carbonate?
The IUPAC name of ethanol;ethyl methyl carbonate (CID 161101393) is ethanol;ethyl methyl carbonate.
What is the SMILES notation for ethanol;ethyl methyl carbonate?
The canonical SMILES for ethanol;ethyl methyl carbonate is CCO.CCOC(=O)OC.
What is the InChIKey of ethanol;ethyl methyl carbonate?
The InChIKey is UILXAFGEPVTJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C2H6O/c1-3-7-4(5)6-2;1-2-3/h3H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl methyl carbonate?
ethanol;ethyl methyl carbonate has a molecular weight of 150.17 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl methyl carbonate is sourced from PubChem (CID 161101393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).