About ethyl methyl carbonate;prop-2-enyl hydrogen carbonate
ethyl methyl carbonate;prop-2-enyl hydrogen carbonate (PubChem CID 174592666) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is ethyl methyl carbonate;prop-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | ethyl methyl carbonate;prop-2-enyl hydrogen carbonate |
| PubChem CID | 174592666 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | ethyl methyl carbonate;prop-2-enyl hydrogen carbonate |
| SMILES | C=CCOC(=O)O.CCOC(=O)OC |
| InChI | InChI=1S/C4H8O3.C4H6O3/c1-3-7-4(5)6-2;1-2-3-7-4(5)6/h3H2,1-2H3;2H,1,3H2,(H,5,6) |
| InChIKey | BCJGTAFOGSNFTE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl methyl carbonate;prop-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl methyl carbonate;prop-2-enyl hydrogen carbonate?
The IUPAC name of ethyl methyl carbonate;prop-2-enyl hydrogen carbonate (CID 174592666) is ethyl methyl carbonate;prop-2-enyl hydrogen carbonate.
What is the SMILES notation for ethyl methyl carbonate;prop-2-enyl hydrogen carbonate?
The canonical SMILES for ethyl methyl carbonate;prop-2-enyl hydrogen carbonate is C=CCOC(=O)O.CCOC(=O)OC.
What is the InChIKey of ethyl methyl carbonate;prop-2-enyl hydrogen carbonate?
The InChIKey is BCJGTAFOGSNFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C4H6O3/c1-3-7-4(5)6-2;1-2-3-7-4(5)6/h3H2,1-2H3;2H,1,3H2,(H,5,6).
What are the key properties of ethyl methyl carbonate;prop-2-enyl hydrogen carbonate?
ethyl methyl carbonate;prop-2-enyl hydrogen carbonate has a molecular weight of 206.19 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl methyl carbonate;prop-2-enyl hydrogen carbonate is sourced from PubChem (CID 174592666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).