C12H21F2O9P — CID 170229009
1-[1,1-difluoroethyl(1-ethoxycarbonyloxyethoxy)phosphoryl]oxyethyl ethyl carbonate (PubChem CID 170229009) has the molecular formula C12H21F2O9P and a molecular weight of 378.26 g/mol. Its IUPAC name is 1-[1,1-difluoroethyl(1-ethoxycarbonyloxyethoxy)phosphoryl]oxyethyl ethyl carbonate.
| Compound Name | 1-[1,1-difluoroethyl(1-ethoxycarbonyloxyethoxy)phosphoryl]oxyethyl ethyl carbonate |
|---|---|
| PubChem CID | 170229009 |
| Molecular Formula | C12H21F2O9P |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[1,1-difluoroethyl(1-ethoxycarbonyloxyethoxy)phosphoryl]oxyethyl ethyl carbonate |
| SMILES | CCOC(=O)OC(C)OP(=O)(OC(C)OC(=O)OCC)C(C)(F)F |
| InChI | InChI=1S/C12H21F2O9P/c1-6-18-10(15)20-8(3)22-24(17,12(5,13)14)23-9(4)21-11(16)19-7-2/h8-9H,6-7H2,1-5H3 |
| InChIKey | LEEJZVXAHMYPIW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|