C10H16F3NO7 — CID 87288485
1-ethoxycarbonyloxyethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid (PubChem CID 87288485) has the molecular formula C10H16F3NO7 and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 1-ethoxycarbonyloxyethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87288485 |
| Molecular Formula | C10H16F3NO7 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl (2S)-2-aminopropanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)OC(C)OC(=O)[C@H](C)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H15NO5.C2HF3O2/c1-4-12-8(11)14-6(3)13-7(10)5(2)9;3-2(4,5)1(6)7/h5-6H,4,9H2,1-3H3;(H,6,7)/t5-,6?;/m0./s1 |
| InChIKey | ZRIHRVWAKQMRFE-GNVLWMSISA-N |
| XLogP | 1.03 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|