C11H23N2O6P — CID 174312194
ethyl 2-(1-dimethoxyphosphorylbutylcarbamoylamino)acetate (PubChem CID 174312194) has the molecular formula C11H23N2O6P and a molecular weight of 310.29 g/mol. Its IUPAC name is ethyl 2-(1-dimethoxyphosphorylbutylcarbamoylamino)acetate.
| Compound Name | ethyl 2-(1-dimethoxyphosphorylbutylcarbamoylamino)acetate |
|---|---|
| PubChem CID | 174312194 |
| Molecular Formula | C11H23N2O6P |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl 2-(1-dimethoxyphosphorylbutylcarbamoylamino)acetate |
| SMILES | CCCC(NC(=O)NCC(=O)OCC)P(=O)(OC)OC |
| InChI | InChI=1S/C11H23N2O6P/c1-5-7-9(20(16,17-3)18-4)13-11(15)12-8-10(14)19-6-2/h9H,5-8H2,1-4H3,(H2,12,13,15) |
| InChIKey | ALTPYHSMFLEBGN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|