C19H23N2O6P — CID 88828280
2-(1-diphenoxyphosphorylbutylcarbamoylamino)acetic acid (PubChem CID 88828280) has the molecular formula C19H23N2O6P and a molecular weight of 406.38 g/mol. Its IUPAC name is 2-(1-diphenoxyphosphorylbutylcarbamoylamino)acetic acid.
| Compound Name | 2-(1-diphenoxyphosphorylbutylcarbamoylamino)acetic acid |
|---|---|
| PubChem CID | 88828280 |
| Molecular Formula | C19H23N2O6P |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(1-diphenoxyphosphorylbutylcarbamoylamino)acetic acid |
| SMILES | CCCC(NC(=O)NCC(=O)O)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C19H23N2O6P/c1-2-9-17(21-19(24)20-14-18(22)23)28(25,26-15-10-5-3-6-11-15)27-16-12-7-4-8-13-16/h3-8,10-13,17H,2,9,14H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | ZQTGZSYUTFGBRI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|