C27H32Cl3N3O6P2 — CID 15312766
1-[bis(2-chloroethyl)amino-(4-chlorophenoxy)phosphoryl]-3-(1-diphenoxyphosphorylbutyl)urea (PubChem CID 15312766) has the molecular formula C27H32Cl3N3O6P2 and a molecular weight of 662.88 g/mol. Its IUPAC name is 1-[bis(2-chloroethyl)amino-(4-chlorophenoxy)phosphoryl]-3-(1-diphenoxyphosphorylbutyl)urea.
| Compound Name | 1-[bis(2-chloroethyl)amino-(4-chlorophenoxy)phosphoryl]-3-(1-diphenoxyphosphorylbutyl)urea |
|---|---|
| PubChem CID | 15312766 |
| Molecular Formula | C27H32Cl3N3O6P2 |
| Molecular Weight | 662.88 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | 1-[bis(2-chloroethyl)amino-(4-chlorophenoxy)phosphoryl]-3-(1-diphenoxyphosphorylbutyl)urea |
| SMILES | CCCC(NC(=O)NP(=O)(Oc1ccc(Cl)cc1)N(CCCl)CCCl)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C27H32Cl3N3O6P2/c1-2-9-26(40(35,37-23-10-5-3-6-11-23)38-24-12-7-4-8-13-24)31-27(34)32-41(36,33(20-18-28)21-19-29)39-25-16-14-22(30)15-17-25/h3-8,10-17,26H,2,9,18-21H2,1H3,(H2,31,32,34,36) |
| InChIKey | NNCMUKRYBRPVRC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|