C22H32N3O4P — CID 10993761
(2S)-2,6-diamino-N-(1-diphenoxyphosphorylbutyl)hexanamide (PubChem CID 10993761) has the molecular formula C22H32N3O4P and a molecular weight of 433.49 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(1-diphenoxyphosphorylbutyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(1-diphenoxyphosphorylbutyl)hexanamide |
|---|---|
| PubChem CID | 10993761 |
| Molecular Formula | C22H32N3O4P |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (2S)-2,6-diamino-N-(1-diphenoxyphosphorylbutyl)hexanamide |
| SMILES | CCCC(NC(=O)[C@@H](N)CCCCN)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H32N3O4P/c1-2-11-21(25-22(26)20(24)16-9-10-17-23)30(27,28-18-12-5-3-6-13-18)29-19-14-7-4-8-15-19/h3-8,12-15,20-21H,2,9-11,16-17,23-24H2,1H3,(H,25,26)/t20-,21?/m0/s1 |
| InChIKey | YRUODNOQCVIIQZ-BGERDNNASA-N |
| XLogP | 4.04 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|