C21H30N2O6P2 — CID 171988637
1-[(1-diphenoxyphosphorylbutylamino)-methoxyphosphoryl]-N-propan-2-ylformamide (PubChem CID 171988637) has the molecular formula C21H30N2O6P2 and a molecular weight of 468.43 g/mol. Its IUPAC name is 1-[(1-diphenoxyphosphorylbutylamino)-methoxyphosphoryl]-N-propan-2-ylformamide.
| Compound Name | 1-[(1-diphenoxyphosphorylbutylamino)-methoxyphosphoryl]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 171988637 |
| Molecular Formula | C21H30N2O6P2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-[(1-diphenoxyphosphorylbutylamino)-methoxyphosphoryl]-N-propan-2-ylformamide |
| SMILES | CCCC(NP(=O)(OC)C(=O)NC(C)C)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C21H30N2O6P2/c1-5-12-20(23-30(25,27-4)21(24)22-17(2)3)31(26,28-18-13-8-6-9-14-18)29-19-15-10-7-11-16-19/h6-11,13-17,20H,5,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | HUDUJYXZGTVSFN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|