C23H33N2O4P — CID 10906158
(2S,3S)-2-amino-N-(1-diphenoxyphosphoryl-2-methylbutyl)-3-methylpentanamide (PubChem CID 10906158) has the molecular formula C23H33N2O4P and a molecular weight of 432.50 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-(1-diphenoxyphosphoryl-2-methylbutyl)-3-methylpentanamide.
| Compound Name | (2S,3S)-2-amino-N-(1-diphenoxyphosphoryl-2-methylbutyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 10906158 |
| Molecular Formula | C23H33N2O4P |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (2S,3S)-2-amino-N-(1-diphenoxyphosphoryl-2-methylbutyl)-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)[C@@H](N)[C@@H](C)CC)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H33N2O4P/c1-5-17(3)21(24)22(26)25-23(18(4)6-2)30(27,28-19-13-9-7-10-14-19)29-20-15-11-8-12-16-20/h7-18,21,23H,5-6,24H2,1-4H3,(H,25,26)/t17-,18?,21-,23?/m0/s1 |
| InChIKey | MHSYPAGAKFCIPW-FCHICCFQSA-N |
| XLogP | 5.20 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|