C17H22N2OS — CID 43708998
2-amino-3-methyl-N-[phenyl(thiophen-2-yl)methyl]pentanamide (PubChem CID 43708998) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[phenyl(thiophen-2-yl)methyl]pentanamide.
| Compound Name | 2-amino-3-methyl-N-[phenyl(thiophen-2-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 43708998 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-amino-3-methyl-N-[phenyl(thiophen-2-yl)methyl]pentanamide |
| SMILES | CCC(C)C(N)C(=O)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C17H22N2OS/c1-3-12(2)15(18)17(20)19-16(14-10-7-11-21-14)13-8-5-4-6-9-13/h4-12,15-16H,3,18H2,1-2H3,(H,19,20) |
| InChIKey | JDPQDDOVPJXRGZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |