C22H27O6P — CID 177463001
ethyl 2-diphenoxyphosphoryl-6-methyl-5-oxoheptanoate (PubChem CID 177463001) has the molecular formula C22H27O6P and a molecular weight of 418.43 g/mol. Its IUPAC name is ethyl 2-diphenoxyphosphoryl-6-methyl-5-oxoheptanoate.
| Compound Name | ethyl 2-diphenoxyphosphoryl-6-methyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 177463001 |
| Molecular Formula | C22H27O6P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 2-diphenoxyphosphoryl-6-methyl-5-oxoheptanoate |
| SMILES | CCOC(=O)C(CCC(=O)C(C)C)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H27O6P/c1-4-26-22(24)21(16-15-20(23)17(2)3)29(25,27-18-11-7-5-8-12-18)28-19-13-9-6-10-14-19/h5-14,17,21H,4,15-16H2,1-3H3 |
| InChIKey | VVFHZXDIPLZSDY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|