C18H22NO5P — CID 59132351
ethyl (2S)-2-[(4-aminophenyl)methyl-phenoxyphosphoryl]oxypropanoate (PubChem CID 59132351) has the molecular formula C18H22NO5P and a molecular weight of 363.35 g/mol. Its IUPAC name is ethyl (2S)-2-[(4-aminophenyl)methyl-phenoxyphosphoryl]oxypropanoate.
| Compound Name | ethyl (2S)-2-[(4-aminophenyl)methyl-phenoxyphosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 59132351 |
| Molecular Formula | C18H22NO5P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | ethyl (2S)-2-[(4-aminophenyl)methyl-phenoxyphosphoryl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](C)OP(=O)(Cc1ccc(N)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H22NO5P/c1-3-22-18(20)14(2)23-25(21,24-17-7-5-4-6-8-17)13-15-9-11-16(19)12-10-15/h4-12,14H,3,13,19H2,1-2H3/t14-,25?/m0/s1 |
| InChIKey | XSPUVRMUZRFKDS-GQBYZMJGSA-N |
| XLogP | 4.01 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|