C26H26Cl2NO8P — CID 59810136
2-[2-[2,6-dichloro-4-[[(1-ethoxy-1-oxopropan-2-yl)oxy-phenoxyphosphoryl]methoxy]anilino]phenyl]acetic acid (PubChem CID 59810136) has the molecular formula C26H26Cl2NO8P and a molecular weight of 582.37 g/mol. Its IUPAC name is 2-[2-[2,6-dichloro-4-[[(1-ethoxy-1-oxopropan-2-yl)oxy-phenoxyphosphoryl]methoxy]anilino]phenyl]acetic acid.
| Compound Name | 2-[2-[2,6-dichloro-4-[[(1-ethoxy-1-oxopropan-2-yl)oxy-phenoxyphosphoryl]methoxy]anilino]phenyl]acetic acid |
|---|---|
| PubChem CID | 59810136 |
| Molecular Formula | C26H26Cl2NO8P |
| Molecular Weight | 582.37 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | 2-[2-[2,6-dichloro-4-[[(1-ethoxy-1-oxopropan-2-yl)oxy-phenoxyphosphoryl]methoxy]anilino]phenyl]acetic acid |
| SMILES | CCOC(=O)C(C)OP(=O)(COc1cc(Cl)c(Nc2ccccc2CC(=O)O)c(Cl)c1)Oc1ccccc1 |
| InChI | InChI=1S/C26H26Cl2NO8P/c1-3-34-26(32)17(2)36-38(33,37-19-10-5-4-6-11-19)16-35-20-14-21(27)25(22(28)15-20)29-23-12-8-7-9-18(23)13-24(30)31/h4-12,14-15,17,29H,3,13,16H2,1-2H3,(H,30,31) |
| InChIKey | YUDAMEUINDQOMV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.37 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|