C13H19O6P — CID 58929000
ethyl (2S)-2-[2-hydroxyethyl(phenoxy)phosphoryl]oxypropanoate (PubChem CID 58929000) has the molecular formula C13H19O6P and a molecular weight of 302.26 g/mol. Its IUPAC name is ethyl (2S)-2-[2-hydroxyethyl(phenoxy)phosphoryl]oxypropanoate.
| Compound Name | ethyl (2S)-2-[2-hydroxyethyl(phenoxy)phosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 58929000 |
| Molecular Formula | C13H19O6P |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | ethyl (2S)-2-[2-hydroxyethyl(phenoxy)phosphoryl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](C)OP(=O)(CCO)Oc1ccccc1 |
| InChI | InChI=1S/C13H19O6P/c1-3-17-13(15)11(2)18-20(16,10-9-14)19-12-7-5-4-6-8-12/h4-8,11,14H,3,9-10H2,1-2H3/t11-,20?/m0/s1 |
| InChIKey | ODDGRVOYVIBRSX-ZOZMEPSFSA-N |
| XLogP | 2.22 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|