C15H24NO4P — CID 122527443
ethyl (2R)-2-[[tert-butyl(phenoxy)phosphoryl]amino]propanoate (PubChem CID 122527443) has the molecular formula C15H24NO4P and a molecular weight of 313.33 g/mol. Its IUPAC name is ethyl (2R)-2-[[tert-butyl(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[tert-butyl(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122527443 |
| Molecular Formula | C15H24NO4P |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl (2R)-2-[[tert-butyl(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NP(=O)(Oc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H24NO4P/c1-6-19-14(17)12(2)16-21(18,15(3,4)5)20-13-10-8-7-9-11-13/h7-12H,6H2,1-5H3,(H,16,18)/t12-,21?/m1/s1 |
| InChIKey | QESPJTOVXOMKAN-FXADVQPWSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|