C17H27FNO4P — CID 176768681
propyl 2-[[(1-fluoro-2,2-dimethylpropyl)-phenoxyphosphoryl]amino]propanoate (PubChem CID 176768681) has the molecular formula C17H27FNO4P and a molecular weight of 359.38 g/mol. Its IUPAC name is propyl 2-[[(1-fluoro-2,2-dimethylpropyl)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propyl 2-[[(1-fluoro-2,2-dimethylpropyl)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 176768681 |
| Molecular Formula | C17H27FNO4P |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | propyl 2-[[(1-fluoro-2,2-dimethylpropyl)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)C(C)NP(=O)(Oc1ccccc1)C(F)C(C)(C)C |
| InChI | InChI=1S/C17H27FNO4P/c1-6-12-22-15(20)13(2)19-24(21,16(18)17(3,4)5)23-14-10-8-7-9-11-14/h7-11,13,16H,6,12H2,1-5H3,(H,19,21) |
| InChIKey | PFTLAFUEGCPVNS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|